1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate
Modify Date: 2026-07-03 00:51:52
1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate structure
|
Common Name | 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 577-69-5 | Molecular Weight | 244.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17FO4 |
|---|---|
| Molecular Weight | 244.26 |
| InChIKey | HMIKNTQXNUOTKY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC=C(F)CC1C(=O)OCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 577-69-5? |
| A: Chinese name of 577-69-5 is 577-69-5. |
| Q: What is the SMILES notation of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: SMILES notation of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is CCOC(=O)C1CC=C(F)CC1C(=O)OCC. |
| Q: What is the molecular formula of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: Molecular formula of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is C12H17FO4. |
| Q: What is the molecular weight of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: Molecular weight of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is 244.26. |
| Q: What is the CAS number of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: CAS number of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is 577-69-5. |
| Q: What is the InChIKey of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: InChIKey of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is HMIKNTQXNUOTKY-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate? |
| A: The English name of 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate is 1,2-Diethyl 4-fluoro-4-cyclohexene-1,2-dicarboxylate. |