2-(4-Fluorophenyl)-3-methylquinoline structure
|
Common Name | 2-(4-Fluorophenyl)-3-methylquinoline | ||
|---|---|---|---|---|
| CAS Number | 577-90-2 | Molecular Weight | 237.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Fluorophenyl)-3-methylquinoline |
|---|
| Molecular Formula | C16H12FN |
|---|---|
| Molecular Weight | 237.27 |
| InChIKey | RJIIIMSZBCOOOD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC=CC=C2N=C1C3=CC=C(C=C3)F |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Chemical Probes of Kaposi's Sarcoma Herpes Virus Latent Infection
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: ORF 73 [Human herpesvirus 8 type M]
External Id: HMS791
|