Pheniodol structure
|
Common Name | Pheniodol | ||
|---|---|---|---|---|
| CAS Number | 577-91-3 | Molecular Weight | 494.06300 | |
| Density | 2.081g/cm3 | Boiling Point | 439ºC at 760 mmHg | |
| Molecular Formula | C15H12I2O3 | Melting Point | 164°C | |
| MSDS | N/A | Flash Point | 219.3ºC | |
Use of PheniodolIodoalphionic acid is a biochemical. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.081g/cm3 |
|---|---|
| Boiling Point | 439ºC at 760 mmHg |
| Melting Point | 164°C |
| Molecular Formula | C15H12I2O3 |
| Molecular Weight | 494.06300 |
| Flash Point | 219.3ºC |
| Exact Mass | 493.88800 |
| PSA | 57.53000 |
| LogP | 4.01230 |
| Index of Refraction | 1.724 |
| InChIKey | IKYIXZSIKOYSLD-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1cc(I)c(O)c(I)c1)c1ccccc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918290000 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(3.5-Dijod-4-hydroxy-phenyl)-2-phenyl-propionsaeure |
| 3-(4-hydroxy-3,5-diiodo-phenyl)-2-phenyl-propionic acid |
| Coletrast |
| Biliselectan |
| Jodobil |
| 3-(4-Hydroxy-3,5-diiodo-phenyl)-2-phenyl-propanoic acid |
| 3-(4-Hydroxy-3,5-dijod-phenyl)-2-phenyl-propionsaeure |
| Biliognost |
| Bilitrast |
| Biselectan |
| 2-Phenyl-3-(3,5-dijod-4-hydroxy-phenyl)-propionsaeure |
| Iodoalphionic acid |
| Pheniodol |
| Biliselktan |
| Iodobil |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: Melting point of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 164°C. |
| Q: What is the LogP of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: LogP of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 4.01230. |
| Q: What is the molecular formula of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: Molecular formula of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is C15H12I2O3. |
| Q: What is the InChIKey of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: InChIKey of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is IKYIXZSIKOYSLD-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: The English name of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid. |
| Q: What is the SMILES notation of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: SMILES notation of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is O=C(O)C(Cc1cc(I)c(O)c(I)c1)c1ccccc1. |
| Q: What is the CAS number of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: CAS number of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 577-91-3. |
| Q: What is the polar surface area (PSA) of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: Polar surface area (PSA) of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 57.53000. |
| Q: What are the uses of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: Main uses of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid: Iodoalphionic acid is a biochemical. |
| Q: What is the molecular weight of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid? |
| A: Molecular weight of 3-(4-hydroxy-3,5-diiodophenyl)-2-phenylpropanoic acid is 494.06300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |