tris(2-phenylethyl) phosphate
Modify Date: 2025-09-21 22:17:49
tris(2-phenylethyl) phosphate structure
|
Common Name | tris(2-phenylethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 5770-08-1 | Molecular Weight | 410.44300 | |
| Density | 1.162g/cm3 | Boiling Point | 542.7ºC at 760 mmHg | |
| Molecular Formula | C24H27O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295ºC | |
| Name | tris(2-phenylethyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 542.7ºC at 760 mmHg |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.44300 |
| Flash Point | 295ºC |
| Exact Mass | 410.16500 |
| PSA | 54.57000 |
| LogP | 5.87240 |
| Index of Refraction | 1.567 |
| InChIKey | GLXMYRYTCHAIAL-UHFFFAOYSA-N |
| SMILES | O=P(OCCc1ccccc1)(OCCc1ccccc1)OCCc1ccccc1 |
| HS Code | 2919900090 |
|---|
|
~%
tris(2-phenylet... CAS#:5770-08-1 |
| Literature: Gerrard; Shepherd Journal of the Chemical Society, 1953 , p. 2069,2072 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphoric acid,triphenethyl ester |
| Triphenylaethylphosphat |
| Triphenethyl phosphate |
| Phosphorsaeure-triphenaethylester |