Benzo[h]quinazolin-4(1H)-one, 5,6-dihydro
![Benzo[h]quinazolin-4(1H)-one, 5,6-dihydro Structure](https://image.chemsrc.com/caspic/101/57711-34-9.png)
Benzo[h]quinazolin-4(1H)-one, 5,6-dihydro structure
|
Common Name | Benzo[h]quinazolin-4(1H)-one, 5,6-dihydro | ||
|---|---|---|---|---|
| CAS Number | 57711-34-9 | Molecular Weight | 198.22100 | |
| Density | 1.34g/cm3 | Boiling Point | 382.3ºC at 760 mmHg | |
| Molecular Formula | C12H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-dihydro-1H-benzo[h]quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 382.3ºC at 760 mmHg |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22100 |
| Flash Point | 185ºC |
| Exact Mass | 198.07900 |
| PSA | 46.01000 |
| LogP | 1.94780 |
| Index of Refraction | 1.705 |
| InChIKey | UZBYZWOESBBUFB-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc2c1CCc1ccccc1-2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![BENZO[H]QUINAZOLIN-4(3H)-ONE structure](https://image.chemsrc.com/caspic/245/506418-75-3.png)
CAS#:506418-75-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Hydroxy-5,6-dihydrobenzo<h>quinazoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: The English name of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 5,6-dihydro-1H-benzo[h]quinazolin-4-one. |
| Q: What is the CAS number of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: CAS number of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 57711-34-9. |
| Q: What is the LogP of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: LogP of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 1.94780. |
| Q: What is the boiling point of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: Boiling point of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 382.3ºC at 760 mmHg. |
| Q: What is the molecular weight of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: Molecular weight of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 198.22100. |
| Q: What is the Chinese name of 57711-34-9? |
| A: Chinese name of 57711-34-9 is 57711-34-9. |
| Q: What is the SMILES notation of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: SMILES notation of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is O=c1[nH]cnc2c1CCc1ccccc1-2. |
| Q: What is the InChIKey of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: InChIKey of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is UZBYZWOESBBUFB-UHFFFAOYSA-N. |
| Q: What English synonyms does 5,6-dihydro-1H-benzo[h]quinazolin-4-one have? |
| A: English synonyms of 5,6-dihydro-1H-benzo[h]quinazolin-4-one: 4-Hydroxy-5,6-dihydrobenzoquinazoline. |
| Q: What is the polar surface area (PSA) of 5,6-dihydro-1H-benzo[h]quinazolin-4-one? |
| A: Polar surface area (PSA) of 5,6-dihydro-1H-benzo[h]quinazolin-4-one is 46.01000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |