2-(4-Chloro-3-methylphenyl)-1,2,4-triazine-3,5(2H,4H)-dione structure
|
Common Name | 2-(4-Chloro-3-methylphenyl)-1,2,4-triazine-3,5(2H,4H)-dione | ||
|---|---|---|---|---|
| CAS Number | 57715-76-1 | Molecular Weight | 237.64200 | |
| Density | 1.48 | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN3O2 | Melting Point | 210-212ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chloro-3-methylphenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48 |
|---|---|
| Melting Point | 210-212ºC |
| Molecular Formula | C10H8ClN3O2 |
| Molecular Weight | 237.64200 |
| Exact Mass | 237.03100 |
| PSA | 68.01000 |
| LogP | 1.29490 |
| Index of Refraction | 1.67 |
| InChIKey | WFSCGRSYVANZRL-UHFFFAOYSA-N |
| SMILES | Cc1cc(-n2ncc(=O)[nH]c2=O)ccc1Cl |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-(4-chloro-3-methyl-phenyl)-2H-[1,2,4]triazine-3,5-dione |
| 2-(4-CHLORO-3-METHYLPHENYL)-1,2,4-TRIAZINE-3,5(2H,4H)-DIONE |
| 1,2,4-Triazine-3,5(2H,4H)-dione,2-(4-chloro-3-methylphenyl) |