(13α)-11,15-Dihydroxykaur-16-en-18-oic acid structure
|
Common Name | (13α)-11,15-Dihydroxykaur-16-en-18-oic acid | ||
|---|---|---|---|---|
| CAS Number | 57719-76-3 | Molecular Weight | 334.45 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 512.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.9±26.6 °C | |
Use of (13α)-11,15-Dihydroxykaur-16-en-18-oic acid(4α,11β,15β)-11,15-Dihydroxykaur-16-en-19-oic acid is a compound isolated from the Tunisian Pulicaria laciniata (Coss.et Kral.) Thell. flowers[1]. |
| Name | ent-11,15-Dihydroxykaur-16-en-19-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | (4α,11β,15β)-11,15-Dihydroxykaur-16-en-19-oic acid is a compound isolated from the Tunisian Pulicaria laciniata (Coss.et Kral.) Thell. flowers[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 512.6±50.0 °C at 760 mmHg |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45 |
| Flash Point | 277.9±26.6 °C |
| Exact Mass | 334.214417 |
| PSA | 77.76000 |
| LogP | 2.80 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | VRVOLALMVUEAHP-SWTANJRXSA-N |
| SMILES | C=C1C2CC(O)C3C4(C)CCCC(C)(C(=O)O)C4CCC3(C2)C1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 11,15-Dihydroxy-16-kauren-19-oic acid |
| (5β,8α,9β,10α)-11,15-Dihydroxykaur-16-en-18-oic acid |
| (13α)-11,15-Dihydroxykaur-16-en-18-oic acid |