3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane
![3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane Structure](https://image.chemsrc.com/caspic/375/57722-40-4.png)
3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane structure
|
Common Name | 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 57722-40-4 | Molecular Weight | 182.33500 | |
| Density | 0.94g/cm3 | Boiling Point | 186.5ºC at 760 mmHg | |
| Molecular Formula | C10H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 58ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 186.5ºC at 760 mmHg |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.33500 |
| Flash Point | 58ºC |
| Exact Mass | 182.11300 |
| PSA | 9.23000 |
| LogP | 3.15170 |
| Index of Refraction | 1.476 |
| InChIKey | LWEGGUCCOPWRNB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CC2CCC1C2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:497-38-1![bicyclo[3.2.1]oct-2-en-4-one structure](https://image.chemsrc.com/caspic/149/3212-77-9.png)
CAS#:3212-77-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Trimethylsiloxynorborn-2-en |
| 1-Trimethylsilyloxynorbornen |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: SMILES notation of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is C[Si](C)(C)OC1=CC2CCC1C2. |
| Q: What is the molecular formula of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: Molecular formula of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is C10H18OSi. |
| Q: What is the LogP of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: LogP of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is 3.15170. |
| Q: What is the English name of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: The English name of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane. |
| Q: What is the boiling point of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: Boiling point of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is 186.5ºC at 760 mmHg. |
| Q: What is the InChIKey of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: InChIKey of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is LWEGGUCCOPWRNB-UHFFFAOYSA-N. |
| Q: What are the downstream products of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: Related downstream products(CAS) of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane: 497-38-1;3212-77-9. |
| Q: What is the Chinese name of 57722-40-4? |
| A: Chinese name of 57722-40-4 is 57722-40-4. |
| Q: What English synonyms does 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane have? |
| A: English synonyms of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane: 2-Trimethylsiloxynorborn-2-en, 1-Trimethylsilyloxynorbornen. |
| Q: What is the polar surface area (PSA) of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane? |
| A: Polar surface area (PSA) of 3-bicyclo[2.2.1]hept-2-enyloxy(trimethyl)silane is 9.23000. |