4-(4-methoxy-3-phenylmethoxyphenyl)pyrrolidin-2-one structure
|
Common Name | 4-(4-methoxy-3-phenylmethoxyphenyl)pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 57724-78-4 | Molecular Weight | 297.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methoxy-3-phenylmethoxyphenyl)pyrrolidin-2-one |
|---|
| Molecular Formula | C18H19NO3 |
|---|---|
| Molecular Weight | 297.34800 |
| Exact Mass | 297.13600 |
| PSA | 51.05000 |
| LogP | 3.15360 |
| InChIKey | QLIBRFKGUKUNLP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CNC(=O)C2)cc1OCc1ccccc1 |
|
~75%
4-(4-methoxy-3-... CAS#:57724-78-4 |
| Literature: MEMORY PHARMACEUTICALS CORP. Patent: US2003/139406 A1, 2003 ; US 20030139406 A1 |
|
~73%
4-(4-methoxy-3-... CAS#:57724-78-4 |
| Literature: MEMORY PHARMACEUTICALS CORPORATION; HOFFMANN LA-ROCHE INC. Patent: WO2004/94375 A2, 2004 ; Location in patent: Page 103 ; WO 2004/094375 A2 |
|
~%
4-(4-methoxy-3-... CAS#:57724-78-4 |
| Literature: Marivet; Bourguignon; Lugnier; Mann; Stoclet; Wermuth Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1450 - 1457 |
|
~%
4-(4-methoxy-3-... CAS#:57724-78-4 |
| Literature: Marivet; Bourguignon; Lugnier; Mann; Stoclet; Wermuth Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1450 - 1457 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |