3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3,3-diphenyl-propyl]-3-azabicyclo[3.2.2]nonane structure
|
Common Name | 3-[3-(5-methyl-1,3,4-oxadiazol-2-yl)-3,3-diphenyl-propyl]-3-azabicyclo[3.2.2]nonane | ||
|---|---|---|---|---|
| CAS Number | 57726-69-9 | Molecular Weight | 401.54400 | |
| Density | 1.118g/cm3 | Boiling Point | 572.4ºC at 760 mmHg | |
| Molecular Formula | C26H31N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300ºC | |
| Name | 2-[3-(3-azabicyclo[3.2.2]nonan-3-yl)-1,1-diphenylpropyl]-5-methyl-1,3,4-oxadiazole |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 572.4ºC at 760 mmHg |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.54400 |
| Flash Point | 300ºC |
| Exact Mass | 401.24700 |
| PSA | 42.16000 |
| LogP | 5.16240 |
| Index of Refraction | 1.574 |
| InChIKey | HQSGXYWMLDKYLR-UHFFFAOYSA-N |
| SMILES | Cc1nnc(C(CCN2CC3CCC(CC3)C2)(c2ccccc2)c2ccccc2)o1 |
|
~%
3-[3-(5-methyl-... CAS#:57726-69-9 |
| Literature: Adelstein,G.W. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1221 - 1225 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |