2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline
2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline structure
|
Common Name | 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 57729-76-7 | Molecular Weight | 430.55100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H5Cl3F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H5Cl3F3N3O4 |
|---|---|
| Molecular Weight | 430.55100 |
| Exact Mass | 428.93000 |
| PSA | 103.67000 |
| LogP | 7.34500 |
| InChIKey | XFXLCSUQIILUJK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c(Cl)cc(Cl)cc2Cl)c(C(F)(F)F)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dinitro-N-(... CAS#:57729-76-7 |
| Literature: ICI Patent: AT339089DE2509416 , 19771975 ; Chem.Abstr., 1976 , vol. 84, # 30639 Full Text Show Details Eli Lilly and Co. Patent: FR2325325DE2642148 , 19771977 ; Chem.Abstr., 1977 , vol. 87, # 52925 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-dinitro-2',4',6'-trichloro-6-trifluoromethyldiphenylamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: InChIKey of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is XFXLCSUQIILUJK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: CAS number of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is 57729-76-7. |
| Q: What English synonyms does 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline have? |
| A: English synonyms of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline: 2,4-dinitro-2',4',6'-trichloro-6-trifluoromethyldiphenylamine. |
| Q: What is the English name of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: The English name of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline. |
| Q: What is the SMILES notation of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: SMILES notation of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c(Cl)cc(Cl)cc2Cl)c(C(F)(F)F)c1. |
| Q: What is the polar surface area (PSA) of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: Polar surface area (PSA) of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is 103.67000. |
| Q: What is the molecular weight of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: Molecular weight of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is 430.55100. |
| Q: What is the Chinese name of 57729-76-7? |
| A: Chinese name of 57729-76-7 is 57729-76-7. |
| Q: What is the molecular formula of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: Molecular formula of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is C13H5Cl3F3N3O4. |
| Q: What is the LogP of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline? |
| A: LogP of 2,4-dinitro-N-(2,4,6-trichlorophenyl)-6-(trifluoromethyl)aniline is 7.34500. |