DesMethyl Bromethalin
DesMethyl Bromethalin structure
|
Common Name | DesMethyl Bromethalin | ||
|---|---|---|---|---|
| CAS Number | 57729-86-9 | Molecular Weight | 563.90400 | |
| Density | 2.158g/cm3 | Boiling Point | 438.1ºC at 760 mmHg | |
| Molecular Formula | C13H5Br3F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.158g/cm3 |
|---|---|
| Boiling Point | 438.1ºC at 760 mmHg |
| Molecular Formula | C13H5Br3F3N3O4 |
| Molecular Weight | 563.90400 |
| Flash Point | 218.8ºC |
| Exact Mass | 560.77800 |
| PSA | 103.67000 |
| LogP | 7.67230 |
| Index of Refraction | 1.662 |
| InChIKey | INVHIPJJDSPNJY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c(Br)cc(Br)cc2Br)c(C(F)(F)F)c1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
DesMethyl Brome... CAS#:57729-86-9 |
| Literature: AT339089DE2509416 , ; Chem.Abstr., , vol. 84, # 30639 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4,6-tribromo-2',4'-dinitro-6'-trifluoromethyldiphenylamine |
| Desmethylbromethalin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline have? |
| A: English synonyms of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline: 2,4,6-tribromo-2',4'-dinitro-6'-trifluoromethyldiphenylamine, Desmethylbromethalin. |
| Q: What is the boiling point of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: Boiling point of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 438.1ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: Polar surface area (PSA) of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 103.67000. |
| Q: What is the molecular weight of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: Molecular weight of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 563.90400. |
| Q: What is the InChIKey of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: InChIKey of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is INVHIPJJDSPNJY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: SMILES notation of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2c(Br)cc(Br)cc2Br)c(C(F)(F)F)c1. |
| Q: What is the English name of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: The English name of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline. |
| Q: What is the LogP of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: LogP of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 7.67230. |
| Q: What is the CAS number of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: CAS number of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is 57729-86-9. |
| Q: What is the molecular formula of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline? |
| A: Molecular formula of 2,4-dinitro-N-(2,4,6-tribromophenyl)-6-(trifluoromethyl)aniline is C13H5Br3F3N3O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |