5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide
Modify Date: 2025-09-13 14:25:14
5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide structure
|
Common Name | 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 57730-79-7 | Molecular Weight | 326.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H26N4O2S |
|---|---|
| Molecular Weight | 326.5 |
| InChIKey | GWTRZWVMBRFOTE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1cc(N)ccc1N1CCN(C)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: The English name of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide. |
| Q: What is the Chinese name of 57730-79-7? |
| A: Chinese name of 57730-79-7 is 57730-79-7. |
| Q: What is the molecular weight of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: Molecular weight of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is 326.5. |
| Q: What is the SMILES notation of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: SMILES notation of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is CCN(CC)S(=O)(=O)c1cc(N)ccc1N1CCN(C)CC1. |
| Q: What is the CAS number of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: CAS number of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is 57730-79-7. |
| Q: What is the InChIKey of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: InChIKey of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is GWTRZWVMBRFOTE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide? |
| A: Molecular formula of 5-amino-N,N-diethyl-2-(4-methylpiperazin-1-yl)benzene-1-sulfonamide is C15H26N4O2S. |