1-azabicyclo[2.2.2]octan-3-yl-bis(3-methylphenyl)methanol
Modify Date: 2025-10-04 14:49:31
![1-azabicyclo[2.2.2]octan-3-yl-bis(3-methylphenyl)methanol Structure](https://image.chemsrc.com/caspic/393/57734-71-1.png)
1-azabicyclo[2.2.2]octan-3-yl-bis(3-methylphenyl)methanol structure
|
Common Name | 1-azabicyclo[2.2.2]octan-3-yl-bis(3-methylphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 57734-71-1 | Molecular Weight | 321.45600 | |
| Density | 1.14g/cm3 | Boiling Point | 452.4ºC at 760 mmHg | |
| Molecular Formula | C22H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 1-azabicyclo[2.2.2]octan-3-yl-bis(3-methylphenyl)methanol |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 452.4ºC at 760 mmHg |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.45600 |
| Flash Point | 212.8ºC |
| Exact Mass | 321.20900 |
| PSA | 23.47000 |
| LogP | 3.81900 |
| Index of Refraction | 1.623 |
| InChIKey | KZVSEVOHAFPIRQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(O)(c2cccc(C)c2)C2CN3CCC2CC3)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |