1-azabicyclo[2.2.2]octan-3-yl-bis(4-methylphenyl)methanol structure
|
Common Name | 1-azabicyclo[2.2.2]octan-3-yl-bis(4-methylphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 57734-78-8 | Molecular Weight | 321.45600 | |
| Density | 1.14g/cm3 | Boiling Point | 460.5ºC at 760 mmHg | |
| Molecular Formula | C22H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 1-azabicyclo[2.2.2]octan-3-yl-bis(4-methylphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760 mmHg |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.45600 |
| Flash Point | 220.1ºC |
| Exact Mass | 321.20900 |
| PSA | 23.47000 |
| LogP | 3.81900 |
| Index of Refraction | 1.623 |
| InChIKey | MPYGRCSWFPADAL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C2CN3CCC2CC3)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chinuclidyl-di-<4'-tolyl-carbinol> |