4-amino-3-phenyl-1H-1,2,4-triazol-5-one
4-amino-3-phenyl-1H-1,2,4-triazol-5-one structure
|
Common Name | 4-amino-3-phenyl-1H-1,2,4-triazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 57735-10-1 | Molecular Weight | 176.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-amino-3-phenyl-1H-1,2,4-triazol-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8N4O |
|---|---|
| Molecular Weight | 176.17500 |
| Exact Mass | 176.07000 |
| PSA | 76.96000 |
| LogP | 0.94570 |
| InChIKey | OVCWQZAMXXYERB-UHFFFAOYSA-N |
| SMILES | Nn1c(-c2ccccc2)n[nH]c1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:32550-72-4
CAS#:73324-36-4This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3H-1,2,4-Triazol-3-one,4-amino-2,4-dihydro-5-phenyl |
| 3-phenyl-4-amino-4,5-dihydro-1H-1,2,4-triazol-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-amino-3-phenyl-1H-1,2,4-triazol-5-one have? |
| A: English synonyms of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one: 3H-1,2,4-Triazol-3-one,4-amino-2,4-dihydro-5-phenyl, 3-phenyl-4-amino-4,5-dihydro-1H-1,2,4-triazol-5-one. |
| Q: What is the InChIKey of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: InChIKey of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is OVCWQZAMXXYERB-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: Related downstream products(CAS) of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one: 32550-72-4;73324-36-4. |
| Q: What is the SMILES notation of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: SMILES notation of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is Nn1c(-c2ccccc2)n[nH]c1=O. |
| Q: What is the Chinese name of 57735-10-1? |
| A: Chinese name of 57735-10-1 is 57735-10-1. |
| Q: What is the molecular weight of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: Molecular weight of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is 176.17500. |
| Q: What is the CAS number of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: CAS number of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is 57735-10-1. |
| Q: What is the English name of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: The English name of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is 4-amino-3-phenyl-1H-1,2,4-triazol-5-one. |
| Q: What is the LogP of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: LogP of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is 0.94570. |
| Q: What is the polar surface area (PSA) of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one? |
| A: Polar surface area (PSA) of 4-amino-3-phenyl-1H-1,2,4-triazol-5-one is 76.96000. |