8-azido-6-methoxyquinoline
8-azido-6-methoxyquinoline structure
|
Common Name | 8-azido-6-methoxyquinoline | ||
|---|---|---|---|---|
| CAS Number | 57743-00-7 | Molecular Weight | 200.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-azido-6-methoxyquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8N4O |
|---|---|
| Molecular Weight | 200.19700 |
| Exact Mass | 200.07000 |
| PSA | 71.87000 |
| LogP | 2.63796 |
| InChIKey | LCTYPYLKJZNVLX-UHFFFAOYSA-N |
| SMILES | COc1cc(N=[N+]=[N-])c2ncccc2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 10 | |
CAS#:81852-49-5
CAS#:104369-85-9
CAS#:88609-33-0![6-methoxy-9-pyrrolidin-1-yl-5H-pyrido[2,3-c]azepine structure](https://image.chemsrc.com/caspic/358/88609-23-8.png)
CAS#:88609-23-8
CAS#:88609-36-3![N-cyclohexyl-6-methoxy-5H-pyrido[2,3-c]azepin-9-amine structure](https://image.chemsrc.com/caspic/196/88609-27-2.png)
CAS#:88609-27-2![6-methoxy-9-piperidin-1-yl-5H-pyrido[2,3-c]azepine structure](https://image.chemsrc.com/caspic/272/88609-25-0.png)
CAS#:88609-25-0
CAS#:88609-34-1
CAS#:88609-35-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 8-Azido-6-methoxychinolin |
| 6-methoxy-8-quinolyl azide |
| 8-azido-6-methoxy-quinoline |
| Quinoline,8-azido-6-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 8-azido-6-methoxyquinoline? |
| A: CAS number of 8-azido-6-methoxyquinoline is 57743-00-7. |
| Q: What is the InChIKey of 8-azido-6-methoxyquinoline? |
| A: InChIKey of 8-azido-6-methoxyquinoline is LCTYPYLKJZNVLX-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 8-azido-6-methoxyquinoline? |
| A: Polar surface area (PSA) of 8-azido-6-methoxyquinoline is 71.87000. |
| Q: What English synonyms does 8-azido-6-methoxyquinoline have? |
| A: English synonyms of 8-azido-6-methoxyquinoline: 8-Azido-6-methoxychinolin, 6-methoxy-8-quinolyl azide, 8-azido-6-methoxy-quinoline, Quinoline,8-azido-6-methoxy. |
| Q: What is the SMILES notation of 8-azido-6-methoxyquinoline? |
| A: SMILES notation of 8-azido-6-methoxyquinoline is COc1cc(N=[N+]=[N-])c2ncccc2c1. |
| Q: What are the downstream products of 8-azido-6-methoxyquinoline? |
| A: Related downstream products(CAS) of 8-azido-6-methoxyquinoline: 90-52-8;81852-49-5;104369-85-9;88609-33-0;88609-23-8;88609-36-3;88609-27-2;88609-25-0;88609-34-1;88609-35-2. |
| Q: What are the upstream materials of 8-azido-6-methoxyquinoline? |
| A: Related upstream materials(CAS) of 8-azido-6-methoxyquinoline: 90-52-8. |
| Q: What is the molecular weight of 8-azido-6-methoxyquinoline? |
| A: Molecular weight of 8-azido-6-methoxyquinoline is 200.19700. |
| Q: What is the LogP of 8-azido-6-methoxyquinoline? |
| A: LogP of 8-azido-6-methoxyquinoline is 2.63796. |
| Q: What is the Chinese name of 57743-00-7? |
| A: Chinese name of 57743-00-7 is 57743-00-7. |