methyl 2-oxo-2-(1-oxotetralin-2-yl)acetate structure
|
Common Name | methyl 2-oxo-2-(1-oxotetralin-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 57763-56-1 | Molecular Weight | 232.23200 | |
| Density | 1.262g/cm3 | Boiling Point | 385.7ºC at 760mmHg | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.9ºC | |
| Name | methyl 2-oxo-2-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760mmHg |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23200 |
| Flash Point | 172.9ºC |
| Exact Mass | 232.07400 |
| PSA | 60.44000 |
| LogP | 1.17380 |
| InChIKey | XDAVYSFOCVKRDF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1CCc2ccccc2C1=O |
| HS Code | 2918300090 |
|---|
|
~10%
methyl 2-oxo-2-... CAS#:57763-56-1 |
| Literature: Emerson, David W.; Titus, Richard L.; Gonzalez, Rowena M. Journal of Organic Chemistry, 1991 , vol. 56, # 18 p. 5301 - 5307 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| methyl oxo(1-oxo-1,2,3,4-tetrahydronaphthalen-2-yl)acetate |
| (+-)-(1-Oxo-1,2,3,4-tetrahydro-<2>naphthyl-glyoxylsaeure-methylester |
| methyl 1,2,3,4-tetrahydro-1-oxo-2-naphthaleneglyoxalate |
| (1-oxo-1,2,3,4-tetrahydro-[2]naphthyl)-glyoxylic acid methyl ester |