5-Isopropyl-7-methyl-2H-naphtho[1,8-bc]furan-3,4-diol
Modify Date: 2026-08-15 14:29:52
![5-Isopropyl-7-methyl-2H-naphtho[1,8-bc]furan-3,4-diol Structure](https://image.chemsrc.com/caspic/147/57765-65-8.png)
5-Isopropyl-7-methyl-2H-naphtho[1,8-bc]furan-3,4-diol structure
|
Common Name | 5-Isopropyl-7-methyl-2H-naphtho[1,8-bc]furan-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 57765-65-8 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | desoxyhemigossypol |
|---|
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 49.69000 |
| LogP | 3.57520 |
| InChIKey | UACUHHDLYFQIDS-UHFFFAOYSA-N |
| SMILES | Cc1cc2c3c(c(O)c(O)c(C(C)C)c3c1)CO2 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:40817-07-0|
Name: Antifungal activity against Rhizoctonia solani J-1 after 4 to 5 days
Source: ChEMBL
Target: Rhizoctonia solani
External Id: CHEMBL3082133
|
|
Name: Antifungal activity against Rhizoctonia solani J-1 after 72 hr by turbimetric assay
Source: ChEMBL
Target: Rhizoctonia solani
External Id: CHEMBL3082134
|
Total 2, Current Page 1 of 1
1