((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester
Modify Date: 2026-08-04 13:08:06
((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester structure
|
Common Name | ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 577692-49-0 | Molecular Weight | 268.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19F3N2O2 |
|---|---|
| Molecular Weight | 268.28 |
| InChIKey | IHMWVWBSRVQKQQ-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCNC(C(F)(F)F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: CAS number of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is 577692-49-0. |
| Q: What is the Chinese name of 577692-49-0? |
| A: Chinese name of 577692-49-0 is 577692-49-0. |
| Q: What is the SMILES notation of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: SMILES notation of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is CC(C)(C)OC(=O)NC1CCNC(C(F)(F)F)C1. |
| Q: What is the English name of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: The English name of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester. |
| Q: What is the molecular weight of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: Molecular weight of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is 268.28. |
| Q: What is the molecular formula of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: Molecular formula of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is C11H19F3N2O2. |
| Q: What is the InChIKey of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester? |
| A: InChIKey of ((2S,4S)-2-(trifluoromethyl)piperidin-4-yl) carbamic acid tert-butyl ester is IHMWVWBSRVQKQQ-YUMQZZPRSA-N. |