Imidazo[2,1-b]-1,3,4-thiadiazole, 6-(4-methylphenyl) structure
|
Common Name | Imidazo[2,1-b]-1,3,4-thiadiazole, 6-(4-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 57771-98-9 | Molecular Weight | 215.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Imidazo[2,1-b]-1,3,4-thiadiazole, 6-(4-methylphenyl) |
|---|
| Molecular Formula | C11H9N3S |
|---|---|
| Molecular Weight | 215.28 |
| InChIKey | KLVOYOMLAVRBSH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN3C(=N2)SC=N3 |
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|