Phosphoric acid, monophenyl ester, compd. with cyclohexanamine (1:1) structure
|
Common Name | Phosphoric acid, monophenyl ester, compd. with cyclohexanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 57775-14-1 | Molecular Weight | 273.26500 | |
| Density | N/A | Boiling Point | 346.9ºC at 760 mmHg | |
| Molecular Formula | C12H20NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | cyclohexanamine,phenyl dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 346.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.26500 |
| Flash Point | 163.6ºC |
| Exact Mass | 273.11300 |
| PSA | 102.59000 |
| LogP | 3.13620 |
| InChIKey | AMQPHPZEWBUZGG-UHFFFAOYSA-N |
| SMILES | NC1CCCCC1.O=P(O)(O)Oc1ccccc1 |
| Cyclohexylamin,Salz des Phosphorsaeure-monophenylesters |
| cyclohexylamine,salt of phosphoric acid monophenyl ester |