Topiroxostat tosylate
Modify Date: 2025-09-21 15:13:03
Topiroxostat tosylate structure
|
Common Name | Topiroxostat tosylate | ||
|---|---|---|---|---|
| CAS Number | 577778-88-2 | Molecular Weight | 420.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Topiroxostat tosylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H16N6O3S |
|---|---|
| Molecular Weight | 420.4 |
| InChIKey | HCEPIFBYVFRGOI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N#Cc1cc(-c2n[nH]c(-c3ccncc3)n2)ccn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Topiroxostat tosylate? |
| A: Molecular weight of Topiroxostat tosylate is 420.4. |
| Q: What is the molecular formula of Topiroxostat tosylate? |
| A: Molecular formula of Topiroxostat tosylate is C20H16N6O3S. |
| Q: What is the English name of Topiroxostat tosylate? |
| A: The English name of Topiroxostat tosylate is Topiroxostat tosylate. |
| Q: What is the Chinese name of 577778-88-2? |
| A: Chinese name of 577778-88-2 is 577778-88-2. |
| Q: What is the SMILES notation of Topiroxostat tosylate? |
| A: SMILES notation of Topiroxostat tosylate is Cc1ccc(S(=O)(=O)O)cc1.N#Cc1cc(-c2n[nH]c(-c3ccncc3)n2)ccn1. |
| Q: What is the InChIKey of Topiroxostat tosylate? |
| A: InChIKey of Topiroxostat tosylate is HCEPIFBYVFRGOI-UHFFFAOYSA-N. |
| Q: What is the CAS number of Topiroxostat tosylate? |
| A: CAS number of Topiroxostat tosylate is 577778-88-2. |