9-Iododoxycycline
Modify Date: 2026-08-31 19:43:52
9-Iododoxycycline structure
|
Common Name | 9-Iododoxycycline | ||
|---|---|---|---|---|
| CAS Number | 577795-64-3 | Molecular Weight | 570.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23IN2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-Iododoxycycline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H23IN2O8 |
|---|---|
| Molecular Weight | 570.3 |
| InChIKey | XMLYBSCBLOOJTK-PLYBKPSTSA-N |
| SMILES | CC1c2ccc(I)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 9-Iododoxycycline? |
| A: CAS number of 9-Iododoxycycline is 577795-64-3. |
| Q: What is the molecular weight of 9-Iododoxycycline? |
| A: Molecular weight of 9-Iododoxycycline is 570.3. |
| Q: What is the SMILES notation of 9-Iododoxycycline? |
| A: SMILES notation of 9-Iododoxycycline is CC1c2ccc(I)c(O)c2C(O)=C2C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3C(O)C21. |
| Q: What is the molecular formula of 9-Iododoxycycline? |
| A: Molecular formula of 9-Iododoxycycline is C22H23IN2O8. |
| Q: What is the English name of 9-Iododoxycycline? |
| A: The English name of 9-Iododoxycycline is 9-Iododoxycycline. |
| Q: What is the InChIKey of 9-Iododoxycycline? |
| A: InChIKey of 9-Iododoxycycline is XMLYBSCBLOOJTK-PLYBKPSTSA-N. |
| Q: What is the Chinese name of 577795-64-3? |
| A: Chinese name of 577795-64-3 is 577795-64-3. |