Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside
Modify Date: 2026-09-20 17:53:33
Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside structure
|
Common Name | Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 57784-06-2 | Molecular Weight | 506.50100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H26O9 |
|---|---|
| Molecular Weight | 506.50100 |
| Exact Mass | 506.15800 |
| PSA | 117.59000 |
| LogP | 3.02680 |
| InChIKey | WXFFEILSURAFKL-NRUNVSGISA-N |
| SMILES | COC1OC(COC(=O)c2ccccc2)C(O)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl 2,3,6-tri-O-benzoyl-|A-D-galactopyranoside |
| Methyl D-galactopyranoside 2,3,6-tribenzoate |
| |A-D-Galactopyranoside,methyl,2,3,6-tribenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: Polar surface area (PSA) of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is 117.59000. |
| Q: What is the SMILES notation of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: SMILES notation of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is COC1OC(COC(=O)c2ccccc2)C(O)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1. |
| Q: What English synonyms does Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside have? |
| A: English synonyms of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside: Methyl 2,3,6-tri-O-benzoyl-|A-D-galactopyranoside, Methyl D-galactopyranoside 2,3,6-tribenzoate, |A-D-Galactopyranoside,methyl,2,3,6-tribenzoate. |
| Q: What is the molecular weight of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: Molecular weight of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is 506.50100. |
| Q: What is the Chinese name of 57784-06-2? |
| A: Chinese name of 57784-06-2 is 57784-06-2. |
| Q: What is the English name of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: The English name of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside. |
| Q: What is the CAS number of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: CAS number of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is 57784-06-2. |
| Q: What is the InChIKey of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: InChIKey of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is WXFFEILSURAFKL-NRUNVSGISA-N. |
| Q: What is the molecular formula of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: Molecular formula of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is C28H26O9. |
| Q: What is the LogP of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside? |
| A: LogP of Methyl 2,3,6-tri-O-benzoyl-α-D-glucopyranoside is 3.02680. |