Forphenicine
Forphenicine structure
|
Common Name | Forphenicine | ||
|---|---|---|---|---|
| CAS Number | 57784-96-0 | Molecular Weight | 195.17200 | |
| Density | 1.485g/cm3 | Boiling Point | 419.4ºC at 760mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 419.4ºC at 760mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 207.5ºC |
| Exact Mass | 195.05300 |
| PSA | 100.62000 |
| LogP | 0.98940 |
| Index of Refraction | 1.677 |
| InChIKey | MWSKDGPKFCWPOF-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1ccc(C=O)c(O)c1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| L-(+)-Forphenicin |
| Forphenicine |
| forfenicin |
| 4-Formyl-3-hydroxyphenylglycine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: Boiling point of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 419.4ºC at 760mmHg. |
| Q: What is the LogP of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: LogP of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 0.98940. |
| Q: What is the molecular formula of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: Molecular formula of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is C9H9NO4. |
| Q: What is the molecular weight of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: Molecular weight of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 195.17200. |
| Q: What is the InChIKey of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: InChIKey of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is MWSKDGPKFCWPOF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: The English name of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid. |
| Q: What is the SMILES notation of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: SMILES notation of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is NC(C(=O)O)c1ccc(C=O)c(O)c1. |
| Q: What is the CAS number of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: CAS number of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 57784-96-0. |
| Q: What is the Chinese name of 57784-96-0? |
| A: Chinese name of 57784-96-0 is 57784-96-0. |
| Q: What is the polar surface area (PSA) of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid? |
| A: Polar surface area (PSA) of 2-amino-2-(4-formyl-3-hydroxyphenyl)acetic acid is 100.62000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |