ethyl (3-cyano-4,5-dimethyl-thiophen-2-yl)carbamoylformate structure
|
Common Name | ethyl (3-cyano-4,5-dimethyl-thiophen-2-yl)carbamoylformate | ||
|---|---|---|---|---|
| CAS Number | 57785-66-7 | Molecular Weight | 252.29000 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(3-cyano-4,5-dimethylthiophen-2-yl)amino]-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29000 |
| Exact Mass | 252.05700 |
| PSA | 107.43000 |
| LogP | 1.81118 |
| Index of Refraction | 1.555 |
| InChIKey | QCHOOVZOVWKCLU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1sc(C)c(C)c1C#N |
|
~%
ethyl (3-cyano-... CAS#:57785-66-7 |
| Literature: The Upjohn Company Patent: US3953468 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl [(3-cyano-4,5-dimethylthiophen-2-yl)amino](oxo)acetate |
| Ethyl (3-cyano-4,5-dimethylthiophen-2-yl)-oxamate |