Prostaglandin E2 p-benzamidophenyl ester structure
|
Common Name | Prostaglandin E2 p-benzamidophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 57790-53-1 | Molecular Weight | 547.682 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 646.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C33H41NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.8±31.5 °C | |
Use of Prostaglandin E2 p-benzamidophenyl esterPGE2 p-benzamidophenyl ester is a crystalline derivative of PGE2. |
| Name | [4-(N-formylanilino)phenyl] 7-[(2R)-3-hydroxy-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 646.6±55.0 °C at 760 mmHg |
| Molecular Formula | C33H41NO6 |
| Molecular Weight | 547.682 |
| Flash Point | 344.8±31.5 °C |
| Exact Mass | 547.293396 |
| PSA | 112.93000 |
| LogP | 4.24 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | PDKOSADNQUKMKP-QFPSZITRSA-N |
| SMILES | CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(=O)Oc1ccc(NC(=O)c2ccccc2)cc1 |
| Prosta-5,13-dien-1-oic acid, 11,15-dihydroxy-9-oxo-, 4-(benzoylamino)phenyl ester, (5Z,11α,13E,15S)- |
| 4-(Benzoylamino)phenyl (5Z,11α,13E,15S)-11,15-dihydroxy-9-oxoprosta-5,13-dien-1-oate |