[(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate
Modify Date: 2025-08-27 15:57:58
![[(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate Structure](https://www.chemsrc.com/extcaspic/342/57794-09-9.png)
[(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate structure
|
Common Name | [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 57794-09-9 | Molecular Weight | 274.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18O7 |
|---|---|
| Molecular Weight | 274.27 |
| InChIKey | QKPIXQGRPBEVLX-RFDDSKSZSA-N |
| SMILES | CC(=O)OC1CC(OC(C)=O)C(OC(C)=O)C(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: InChIKey of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is QKPIXQGRPBEVLX-RFDDSKSZSA-N. |
| Q: What is the CAS number of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: CAS number of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is 57794-09-9. |
| Q: What is the Chinese name of 57794-09-9? |
| A: Chinese name of 57794-09-9 is 57794-09-9. |
| Q: What is the SMILES notation of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: SMILES notation of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is CC(=O)OC1CC(OC(C)=O)C(OC(C)=O)C(C)O1. |
| Q: What is the molecular formula of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: Molecular formula of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is C12H18O7. |
| Q: What is the English name of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: The English name of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate. |
| Q: What is the molecular weight of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate? |
| A: Molecular weight of [(2S,3S,4S)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate is 274.27. |