5,6-dimethyl-3-oxo-4H-pyrazine-2-carboxylic acid
5,6-dimethyl-3-oxo-4H-pyrazine-2-carboxylic acid structure
|
Common Name | 5,6-dimethyl-3-oxo-4H-pyrazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 57796-64-2 | Molecular Weight | 168.15000 | |
| Density | 1.44g/cm3 | Boiling Point | 532.2ºC at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.7ºC | |
Summary: 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid (CAS number: 57796-64-2) is an organic compound with molecular formula C7H8N2O3 and molecular weight 168.15. Physical properties include boiling point 532.2°C (760 mmHg) and density 1.44g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 532.2ºC at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Flash Point | 275.7ºC |
| Exact Mass | 168.05300 |
| PSA | 83.05000 |
| LogP | 0.08490 |
| Index of Refraction | 1.614 |
| InChIKey | KAUAWDMQKHADMP-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(=O)O)c(=O)[nH]c1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5,6-dimethyl-3-... CAS#:57796-64-2 |
| Literature: Jones Journal of the American Chemical Society, 1949 , vol. 71, p. 78,79, 80 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6-Dimethyl-3-oxo-3,4-dihydro-pyrazin-2-carbonsaeure |
| 5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: Molecular weight of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 168.15000. |
| Q: What English synonyms does 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid have? |
| A: English synonyms of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid: 5,6-Dimethyl-3-oxo-3,4-dihydro-pyrazin-2-carbonsaeure, 5,6-dimethyl-3-oxo-3,4-dihydropyrazine-2-carboxylic acid. |
| Q: What are the upstream materials of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: Related upstream materials(CAS) of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid: 90000-71-8. |
| Q: What is the molecular formula of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: Molecular formula of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is C7H8N2O3. |
| Q: What is the English name of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: The English name of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid. |
| Q: What is the LogP of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: LogP of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 0.08490. |
| Q: What is the boiling point of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: Boiling point of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 532.2ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: Polar surface area (PSA) of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 83.05000. |
| Q: What is the CAS number of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: CAS number of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is 57796-64-2. |
| Q: What is the SMILES notation of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid? |
| A: SMILES notation of 5,6-dimethyl-2-oxo-1H-pyrazine-3-carboxylic acid is Cc1nc(C(=O)O)c(=O)[nH]c1C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |