3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one structure
|
Common Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 578-71-2 | Molecular Weight | 360.31500 | |
| Density | 1.482g/cm3 | Boiling Point | 607.9ºC at 760 mmHg | |
| Molecular Formula | C18H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9ºC | |
| Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 607.9ºC at 760 mmHg |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.31500 |
| Flash Point | 222.9ºC |
| Exact Mass | 360.08500 |
| PSA | 118.59000 |
| LogP | 2.60260 |
| Index of Refraction | 1.658 |
| InChIKey | RQJFJWHHIIPKGW-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)ccc1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Inhibition of NO production in LPS-stimulated mouse RAW264.7 cells pre-incubated for ...
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL3388890
|
|
Name: Cytotoxicity against mouse RAW264.7 cells at 0.01 to 100 uM after 24 hrs by MTT assay
Source: ChEMBL
Target: RAW264.7
External Id: CHEMBL3389454
|
| 3,5,4'-trihydroxy-6,7,3'-trimethoxyflavone |
| veronicafolin |
| Flavone,3,4',5-trihydroxy-3',6,7-trimethoxy |
| Chrysosplenetin |