Pyrano[3,4-b]indole-1-acetic acid, 1-ethyl-1,3,4,9-tetrahydro-8-propyl- structure
|
Common Name | Pyrano[3,4-b]indole-1-acetic acid, 1-ethyl-1,3,4,9-tetrahydro-8-propyl- | ||
|---|---|---|---|---|
| CAS Number | 57817-27-3 | Molecular Weight | 301.38000 | |
| Density | 1.171g/cm3 | Boiling Point | 515.9ºC at 760 mmHg | |
| Molecular Formula | C18H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
| Name | 2-(1-ethyl-8-propyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171g/cm3 |
|---|---|
| Boiling Point | 515.9ºC at 760 mmHg |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.38000 |
| Flash Point | 265.8ºC |
| Exact Mass | 301.16800 |
| PSA | 62.32000 |
| LogP | 3.77310 |
| Index of Refraction | 1.588 |
| InChIKey | JDLOBSPHOCEVJI-UHFFFAOYSA-N |
| SMILES | CCCc1cccc2c3c([nH]c12)C(CC)(CC(=O)O)OCC3 |
|
~%
Pyrano[3,4-b]in... CAS#:57817-27-3 |
| Literature: Demerson,C.A. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 391 - 395 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1-ethyl-8-propyl-1,3,4,9-tetrahydro-pyrano[3,4-b]indol-1-yl)-acetic acid |