2,2'-methylenebis[4,6-dibromophenol] structure
|
Common Name | 2,2'-methylenebis[4,6-dibromophenol] | ||
|---|---|---|---|---|
| CAS Number | 57863-93-1 | Molecular Weight | 515.81700 | |
| Density | 2.238g/cm3 | Boiling Point | 485.3ºC at 760mmHg | |
| Molecular Formula | C13H8Br4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 2,4-dibromo-6-[(3,5-dibromo-2-hydroxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.238g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760mmHg |
| Molecular Formula | C13H8Br4O2 |
| Molecular Weight | 515.81700 |
| Flash Point | 247.3ºC |
| Exact Mass | 511.72600 |
| PSA | 40.46000 |
| LogP | 5.73860 |
| Index of Refraction | 1.71 |
| InChIKey | FHTRYIHBMTYTQT-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)cc(Br)cc1Cc1cc(Br)cc(Br)c1O |
|
~%
2,2'-methyleneb... CAS#:57863-93-1 |
| Literature: Hawkins Journal of Applied Chemistry, 1956 , vol. 6, p. 125,126 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,6,4',6'-tetrabromo-2,2'-methanediyl-di-phenol |
| 4,6,4',6'-Tetrabrom-2,2'-methandiyl-di-phenol |