2-acetyl-5,5-diphenylpenta-2,4-dienoic acid structure
|
Common Name | 2-acetyl-5,5-diphenylpenta-2,4-dienoic acid | ||
|---|---|---|---|---|
| CAS Number | 57880-86-1 | Molecular Weight | 292.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-acetyl-5,5-diphenylpenta-2,4-dienoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H16O3 |
|---|---|
| Molecular Weight | 292.32900 |
| Exact Mass | 292.11000 |
| PSA | 54.37000 |
| LogP | 3.71830 |
| InChIKey | MJOOOYYJXUCQMZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC=C(c1ccccc1)c1ccccc1)C(=O)O |
|
~%
2-acetyl-5,5-di... CAS#:57880-86-1 |
| Literature: Kato; Chiba Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 10 p. 2263 - 2267 |
|
~%
2-acetyl-5,5-di... CAS#:57880-86-1 |
| Literature: Kato; Chiba; Sato Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 12 p. 3877 - 3879 |
|
~%
2-acetyl-5,5-di... CAS#:57880-86-1 |
| Literature: Kato; Chiba Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 10 p. 2263 - 2267 |
| 2-Acetyl-5,5-diphenyl-2,4-pentadienoic Acid |