1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine
1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine structure
|
Common Name | 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 57883-13-3 | Molecular Weight | 217.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine, Chinese name: 1-(3,4-二氯苯基)-2-(丙-2-烯基)氢嗪, CAS number: 57883-13-3, molecular formula: C9H10Cl2N2, molecular weight: 217.09500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10Cl2N2 |
|---|---|
| Molecular Weight | 217.09500 |
| Exact Mass | 216.02200 |
| PSA | 24.39000 |
| LogP | 3.87410 |
| InChIKey | KJKHJOWAWRSWSQ-UHFFFAOYSA-N |
| SMILES | CC(C)=NNc1ccc(Cl)c(Cl)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:479422-01-0
CAS#:479422-03-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: SMILES notation of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is CC(C)=NNc1ccc(Cl)c(Cl)c1. |
| Q: What is the molecular weight of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: Molecular weight of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is 217.09500. |
| Q: What is the polar surface area (PSA) of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: Polar surface area (PSA) of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is 24.39000. |
| Q: What are the downstream products of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: Related downstream products(CAS) of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine: 479422-01-0;479422-03-2. |
| Q: What is the English name of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: The English name of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine. |
| Q: What is the InChIKey of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: InChIKey of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is KJKHJOWAWRSWSQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: Molecular formula of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is C9H10Cl2N2. |
| Q: What is the Chinese name of 57883-13-3? |
| A: Chinese name of 57883-13-3 is 57883-13-3. |
| Q: What is the LogP of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: LogP of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is 3.87410. |
| Q: What is the CAS number of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine? |
| A: CAS number of 1-(3,4-dichlorophenyl)-2-(propan-2-ylidene)hydrazine is 57883-13-3. |