1,1-dicyclohexyl-3-methyl-urea structure
|
Common Name | 1,1-dicyclohexyl-3-methyl-urea | ||
|---|---|---|---|---|
| CAS Number | 57883-92-8 | Molecular Weight | 238.36900 | |
| Density | 1.01g/cm3 | Boiling Point | 413.2ºC at 760 mmHg | |
| Molecular Formula | C14H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.7ºC | |
| Name | 1,1-dicyclohexyl-3-methylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760 mmHg |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.36900 |
| Flash Point | 203.7ºC |
| Exact Mass | 238.20500 |
| PSA | 32.34000 |
| LogP | 3.68410 |
| Index of Refraction | 1.511 |
| InChIKey | HPROJXIYPFCVAJ-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(C1CCCCC1)C1CCCCC1 |
| HS Code | 2924299090 |
|---|
|
~%
1,1-dicyclohexy... CAS#:57883-92-8 |
| Literature: Mido,Y.; Gohda,T. Bulletin of the Chemical Society of Japan, 1975 , vol. 48, p. 2704 - 2707 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dicyclohexyl-N'-methylurea |