4-Imidazolidinone,5-(1H-indol-3-ylmethyl)-3-phenyl-2-thioxo
Modify Date: 2026-07-11 12:47:35
4-Imidazolidinone,5-(1H-indol-3-ylmethyl)-3-phenyl-2-thioxo structure
|
Common Name | 4-Imidazolidinone,5-(1H-indol-3-ylmethyl)-3-phenyl-2-thioxo | ||
|---|---|---|---|---|
| CAS Number | 5789-24-2 | Molecular Weight | 321.396 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 517.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C18H15N3OS | Melting Point | 183ºC | |
| MSDS | USA | Flash Point | 266.9±27.9 °C | |
| Name | Phenylthiohydantoin-tryptophan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.8±42.0 °C at 760 mmHg |
| Melting Point | 183ºC |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.396 |
| Flash Point | 266.9±27.9 °C |
| Exact Mass | 321.093567 |
| PSA | 80.22000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.768 |
| InChIKey | KZXRWWVROVHSPI-UHFFFAOYSA-N |
| SMILES | O=C1C(Cc2c[nH]c3ccccc23)NC(=S)N1c1ccccc1 |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:103-72-0
CAS#:54-12-6|
Name: Contractile Force Screening of ChemBridge Diverset library for asthma drug discovery
Source: 24015
Target: N/A
External Id: HSPH_Screening_CFS_002
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 4, Current Page 1 of 1
1
| 5-(1H-Indol-3-ylmethyl)-3-phenyl-2-thioxoimidazolidin-4-one |
| phenylthiohydantoin-tryptophan |
| EINECS 227-323-1 |
| 5-(1H-Indol-3-ylmethyl)-3-phenyl-2-thioxo-4-imidazolidinone |
| MFCD00038415 |