7,8,9-Trimethoxy-4,5-dihydronaphtho(2,1-d)isoxazole structure
|
Common Name | 7,8,9-Trimethoxy-4,5-dihydronaphtho(2,1-d)isoxazole | ||
|---|---|---|---|---|
| CAS Number | 57897-29-7 | Molecular Weight | 261.27300 | |
| Density | 1.22g/cm3 | Boiling Point | 425.4ºC at 760 mmHg | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 7,8,9-trimethoxy-4,5-dihydrobenzo[g][1,2]benzoxazole |
|---|
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760 mmHg |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.27300 |
| Flash Point | 211.1ºC |
| Exact Mass | 261.10000 |
| PSA | 53.72000 |
| LogP | 2.46600 |
| Index of Refraction | 1.556 |
| InChIKey | QWCNEFHVRYRXBR-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1OC)-c1oncc1CC2 |
| HS Code | 2934999090 |
|---|
|
~%
7,8,9-Trimethox... CAS#:57897-29-7 |
| Literature: Mawdsley,E.A. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, # 2 p. 239 - 243 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |