Phosphinicacid, bis(3-methylphenyl)- (9CI) structure
|
Common Name | Phosphinicacid, bis(3-methylphenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 57906-75-9 | Molecular Weight | 246.24100 | |
| Density | 1.19g/cm3 | Boiling Point | 480ºC at 760mmHg | |
| Molecular Formula | C14H15O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1ºC | |
| Name | bis(3-methylphenyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 480ºC at 760mmHg |
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.24100 |
| Flash Point | 244.1ºC |
| Exact Mass | 246.08100 |
| PSA | 47.11000 |
| LogP | 2.52460 |
| Index of Refraction | 1.585 |
| InChIKey | DMYUIWLPXRKHAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)P(=O)(C2=CC=CC(=C2)C)O |
| HS Code | 2916399090 |
|---|
|
~%
Phosphinicacid,... CAS#:57906-75-9 |
| Literature: Freedman; Doak Journal of Organic Chemistry, 1959 , vol. 24, p. 638,639 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Di-m-tolyl-phosphinsaeure |
| di-(m-tolyl)phosphinic acid |
| Bis-(m-tolyl)-phosphinsaeure |