Z-Cys(Z)-OH structure
|
Common Name | Z-Cys(Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 57912-35-3 | Molecular Weight | 389.422 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H19NO6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | z-cys(z)-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.422 |
| Exact Mass | 389.093292 |
| PSA | 127.23000 |
| LogP | 4.83 |
| Index of Refraction | 1.606 |
| InChIKey | PXKPRICKEUGRRR-INIZCTEOSA-N |
| SMILES | O=C(NC(CSC(=O)OCc1ccccc1)C(=O)O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
|
~82%
Z-Cys(Z)-OH CAS#:57912-35-3 |
| Literature: University of Pittsburgh Patent: US5602098 A1, 1997 ; |
|
~%
Z-Cys(Z)-OH CAS#:57912-35-3 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 4482,4486 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,S-Bis-benzyloxycarbonyl-L-cystein |
| N-[(phenylmethoxy)carbonyl]-L-cysteine |
| N,S-DIBENZYLOXYCARBONYL-L-CYSTEINE |
| N,S-Bis[(benzyloxy)carbonyl]-L-cysteine |
| N,S-DI-Z-L-CYSTEINE |
| Z-CYSTEINE(Z)-OH |
| N,S-Di-CBZ-L-cysteine |
| N,S-di-carbobenzyloxy-L-cysteine |
| N-S-di-cbz-L-cysteine crystalline |
| phenylmethyl carbonate (ester) |
| N,S-bis-benzyloxycarbonyl-L-cysteine |
| N-(Phenylmethoxycarbonyl)-S-(phenylmethyloxycarbonyl)-L-cysteine |
| L-Cysteine, N,S-bis[(phenylmethoxy)carbonyl]- |
| N,S-DICARBOBENZOXY-L-CYSTEINE |
| Cbz-Cys(Cbz)-OH |