4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone
Modify Date: 2026-08-22 18:30:20
4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone structure
|
Common Name | 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 57945-74-1 | Molecular Weight | 349.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H9Cl2F3O2 |
|---|---|
| Molecular Weight | 349.1 |
| InChIKey | ALPFBHIFEOTLGF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: SMILES notation of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is CC(=O)c1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)cc1. |
| Q: What is the InChIKey of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: InChIKey of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is ALPFBHIFEOTLGF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: Molecular weight of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is 349.1. |
| Q: What is the molecular formula of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: Molecular formula of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is C15H9Cl2F3O2. |
| Q: What is the English name of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: The English name of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone. |
| Q: What is the Chinese name of 57945-74-1? |
| A: Chinese name of 57945-74-1 is 57945-74-1. |
| Q: What is the CAS number of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone? |
| A: CAS number of 4'-(2,6-Dichloro-4-trifluoromethyl)phenoxyacetophenone is 57945-74-1. |