3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester
Modify Date: 2026-09-25 21:04:03
![3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester Structure](https://www.chemsrc.com/extcaspic/383/579475-89-1.png)
3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester structure
|
Common Name | 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 579475-89-1 | Molecular Weight | 351.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H25NO3 |
|---|---|
| Molecular Weight | 351.4 |
| InChIKey | BXORTACACMHLNU-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cccc(C(=O)CC(=O)OC(C)(C)C)c2)cc(C2CC2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 579475-89-1? |
| A: Chinese name of 579475-89-1 is 579475-89-1. |
| Q: What is the CAS number of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: CAS number of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is 579475-89-1. |
| Q: What is the English name of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: The English name of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester. |
| Q: What is the SMILES notation of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: SMILES notation of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is Cc1cc(-c2cccc(C(=O)CC(=O)OC(C)(C)C)c2)cc(C2CC2)n1. |
| Q: What is the molecular formula of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: Molecular formula of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is C22H25NO3. |
| Q: What is the InChIKey of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: InChIKey of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is BXORTACACMHLNU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester? |
| A: Molecular weight of 3-[3-(2-Cyclopropyl-6-methyl-pyridin-4-yl)-phenyl]-3-oxo-propionic acid tert-butyl ester is 351.4. |