9H-Carbazole-2-carbonitrile
9H-Carbazole-2-carbonitrile structure
|
Common Name | 9H-Carbazole-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 57955-18-7 | Molecular Weight | 192.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 9H-咔唑-2-甲腈 (9H-Carbazole-2-carbonitrile, CAS: 57955-18-7), molecular formula C13H8N2, molecular weight 192.21600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9H-Carbazole-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H8N2 |
|---|---|
| Molecular Weight | 192.21600 |
| Exact Mass | 192.06900 |
| PSA | 39.58000 |
| LogP | 3.19278 |
| InChIKey | VEQWEUBVPCXIDK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc2c(c1)[nH]c1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| carbazole-2-carbonitrile |
| 2-Cyanocarbazol |
| Carbazol-2-carbonitril |
| 2-cyanocarbazole |
| 3-cyanocarbazole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 9H-Carbazole-2-carbonitrile? |
| A: Molecular formula of 9H-Carbazole-2-carbonitrile is C13H8N2. |
| Q: What is the CAS number of 9H-Carbazole-2-carbonitrile? |
| A: CAS number of 9H-Carbazole-2-carbonitrile is 57955-18-7. |
| Q: What is the SMILES notation of 9H-Carbazole-2-carbonitrile? |
| A: SMILES notation of 9H-Carbazole-2-carbonitrile is N#Cc1ccc2c(c1)[nH]c1ccccc12. |
| Q: What is the molecular weight of 9H-Carbazole-2-carbonitrile? |
| A: Molecular weight of 9H-Carbazole-2-carbonitrile is 192.21600. |
| Q: What is the polar surface area (PSA) of 9H-Carbazole-2-carbonitrile? |
| A: Polar surface area (PSA) of 9H-Carbazole-2-carbonitrile is 39.58000. |
| Q: What English synonyms does 9H-Carbazole-2-carbonitrile have? |
| A: English synonyms of 9H-Carbazole-2-carbonitrile: carbazole-2-carbonitrile, 2-Cyanocarbazol, Carbazol-2-carbonitril, 2-cyanocarbazole, 3-cyanocarbazole. |
| Q: What is the English name of 9H-Carbazole-2-carbonitrile? |
| A: The English name of 9H-Carbazole-2-carbonitrile is 9H-Carbazole-2-carbonitrile. |
| Q: What is the InChIKey of 9H-Carbazole-2-carbonitrile? |
| A: InChIKey of 9H-Carbazole-2-carbonitrile is VEQWEUBVPCXIDK-UHFFFAOYSA-N. |
| Q: What is the LogP of 9H-Carbazole-2-carbonitrile? |
| A: LogP of 9H-Carbazole-2-carbonitrile is 3.19278. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |