6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol structure
|
Common Name | 6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol | ||
|---|---|---|---|---|
| CAS Number | 57956-69-1 | Molecular Weight | 252.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-hydroxypropan-2-yl)-2,9-dimethyldeca-3,5-dien-7-yne-2,9-diol |
|---|
| Molecular Formula | C15H24O3 |
|---|---|
| Molecular Weight | 252.34900 |
| Exact Mass | 252.17300 |
| PSA | 60.69000 |
| LogP | 1.78510 |
| InChIKey | SVJPHTBNOANREV-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C#CC(=CC=CC(C)(C)O)C(C)(C)O |
|
~%
6-(2-hydroxypro... CAS#:57956-69-1 |
| Literature: Singer,H.; Wilkinson,G. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1968 , p. 849 - 853 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |