2,4-Pteridinediamine,6-[[(2-phenylethyl)amino]methyl]- structure
|
Common Name | 2,4-Pteridinediamine,6-[[(2-phenylethyl)amino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 57963-51-6 | Molecular Weight | 295.34200 | |
| Density | 1.343g/cm3 | Boiling Point | 570.3ºC at 760 mmHg | |
| Molecular Formula | C15H17N7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.7ºC | |
| Name | 6-[(2-phenylethylamino)methyl]pteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 570.3ºC at 760 mmHg |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.34200 |
| Flash Point | 298.7ºC |
| Exact Mass | 295.15500 |
| PSA | 115.63000 |
| LogP | 2.46980 |
| Index of Refraction | 1.723 |
| InChIKey | GOUACEBSPNZFIR-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc(CNCCc3ccccc3)cnc2n1 |
|
~%
2,4-Pteridinedi... CAS#:57963-51-6 |
| Literature: The United States of America as represented by the Department of Health, Education and Welfare Patent: US4077957 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-[(phenethylamino)methyl]pteridine-2,4-diamine |
| 6-[(Phenethylamino)methyl]-2,4-Pteridinediamine |