2,3,5,6-tetrakis(ethylsulfanyl)cyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,3,5,6-tetrakis(ethylsulfanyl)cyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 57998-67-1 | Molecular Weight | 348.56700 | |
| Density | 1.25g/cm3 | Boiling Point | 450ºC at 760 mmHg | |
| Molecular Formula | C14H20O2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | 2,3,5,6-tetrakis(ethylsulfanyl)cyclohexa-2,5-diene-1,4-dione |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 450ºC at 760 mmHg |
| Molecular Formula | C14H20O2S4 |
| Molecular Weight | 348.56700 |
| Flash Point | 185.4ºC |
| Exact Mass | 348.03500 |
| PSA | 135.34000 |
| LogP | 4.57380 |
| Index of Refraction | 1.61 |
| InChIKey | OZMJRZYHHPGHFM-UHFFFAOYSA-N |
| SMILES | CCSC1=C(SCC)C(=O)C(SCC)=C(SCC)C1=O |
|
~%
2,3,5,6-tetraki... CAS#:57998-67-1 |
| Literature: Ibis, Cemil; Ayla, Sibel Sahinler; Dogan, Yagmur; Ozen, Mesut Synthetic Communications, 2014 , vol. 44, # 11 p. 1614 - 1618 |
|
~%
2,3,5,6-tetraki... CAS#:57998-67-1 |
| Literature: Grindley; Sammis American Chemical Journal, 1897 , vol. 19, p. 293 |
|
~%
2,3,5,6-tetraki... CAS#:57998-67-1 |
| Literature: Sammis Journal of the American Chemical Society, 1905 , vol. 27, p. 1122 |
|
~6%
2,3,5,6-tetraki... CAS#:57998-67-1 |
| Literature: Kallmayer; Fritzen Pharmazie, 1994 , vol. 49, # 6 p. 412 - 415 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |