1-Isoquinolinecarbonitrile,1,2-dihydro-2-(4-methoxybenzoyl)- structure
|
Common Name | 1-Isoquinolinecarbonitrile,1,2-dihydro-2-(4-methoxybenzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 58021-73-1 | Molecular Weight | 290.31600 | |
| Density | 1.28g/cm3 | Boiling Point | 558.8ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.8ºC | |
| Name | 2-(4-methoxybenzoyl)-1H-isoquinoline-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 558.8ºC at 760 mmHg |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.31600 |
| Flash Point | 291.8ºC |
| Exact Mass | 290.10600 |
| PSA | 53.33000 |
| LogP | 3.32448 |
| Index of Refraction | 1.652 |
| InChIKey | SNJBFUOPFGABIB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)N2C=Cc3ccccc3C2C#N)cc1 |
|
~97%
1-Isoquinolinec... CAS#:58021-73-1 |
| Literature: Duarte, Frederick F.; Popp, Frank D. Heterocycles, 1991 , vol. 32, # 4 p. 723 - 726 |
|
~81%
1-Isoquinolinec... CAS#:58021-73-1 |
| Literature: Reimann, Eberhard; Grasberger, Fritz; Polborn, Kurt Monatshefte fur Chemie, 2003 , vol. 134, # 7 p. 991 - 1014 |
|
~%
1-Isoquinolinec... CAS#:58021-73-1 |
| Literature: Bridge, Andrew W.; Hursthouse, Michael B.; Lehmann, Christian W.; Lythgoe, David J.; Newton, Christopher G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1993 , # 16 p. 1839 - 1848 |
| 1,2-dihydro-2-(4-methoxybenzoyl)isoquinoline-1-carbonitrile |
| 2-(4-methoxybenzoyl)-1,2-dihydroisoquinoline-1-carbonitrile |
| 2-p-Anisoyl-1,2-dihydroisochinaldinonitril |
| 1-Cyano-2-p-anisoyl-1,2-dihydroisochinolin |
| 2-(4-Methoxy-benzoyl)-1-cyan-1,2-dihydro-isochinolin |