1-Propanol, 3,3-[[3- (dibutylamino)propyl]imino]bis-, dimethanesulfonate (ester) structure
|
Common Name | 1-Propanol, 3,3-[[3- (dibutylamino)propyl]imino]bis-, dimethanesulfonate (ester) | ||
|---|---|---|---|---|
| CAS Number | 58045-20-8 | Molecular Weight | 458.67700 | |
| Density | 1.114g/cm3 | Boiling Point | 598ºC at 760 mmHg | |
| Molecular Formula | C19H42N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.5ºC | |
| Name | 3-[3-(dibutylamino)propyl-(3-methylsulfonyloxypropyl)amino]propyl methanesulfonate |
|---|
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 598ºC at 760 mmHg |
| Molecular Formula | C19H42N2O6S2 |
| Molecular Weight | 458.67700 |
| Flash Point | 315.5ºC |
| Exact Mass | 458.24800 |
| PSA | 109.98000 |
| LogP | 4.47490 |
| Index of Refraction | 1.489 |
| InChIKey | JWGORLVGZLHBHP-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCCN(CCCOS(C)(=O)=O)CCCOS(C)(=O)=O |
|
~%
1-Propanol, 3,3... CAS#:58045-20-8 |
| Literature: El Merzabani; Sakurai Chemical and Pharmaceutical Bulletin, 1973 , vol. 21, # 7 p. 1560 - 1563 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |