N-[(1,3-benzothiazol-2-yliminohydrazinylidene)-(diethylamino)-phenyl-λ5-phosphanyl]-N-ethylethanamine structure
|
Common Name | N-[(1,3-benzothiazol-2-yliminohydrazinylidene)-(diethylamino)-phenyl-λ5-phosphanyl]-N-ethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 5806-32-6 | Molecular Weight | 428.53400 | |
| Density | 1.2g/cm3 | Boiling Point | 515.6ºC at 760 mmHg | |
| Molecular Formula | C21H29N6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7ºC | |
| Name | N-[(1,3-benzothiazol-2-yliminohydrazinylidene)-(diethylamino)-phenyl-λ5-phosphanyl]-N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 515.6ºC at 760 mmHg |
| Molecular Formula | C21H29N6PS |
| Molecular Weight | 428.53400 |
| Flash Point | 265.7ºC |
| Exact Mass | 428.19100 |
| PSA | 94.50000 |
| LogP | 6.33530 |
| Index of Refraction | 1.622 |
| InChIKey | ODKIOWSXMWVSQZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)P(=NN=Nc1nc2ccccc2s1)(c1ccccc1)N(CC)CC |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-dimethylamino-1-phenyl-1-pyridin-4-yl-propan-1-ol |