N-octanoyl benzotriazole structure
|
Common Name | N-octanoyl benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 58068-80-7 | Molecular Weight | 245.320 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 379.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2±23.2 °C | |
| Name | 1-(benzotriazol-1-yl)octan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.3±25.0 °C at 760 mmHg |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.320 |
| Flash Point | 183.2±23.2 °C |
| Exact Mass | 245.152817 |
| PSA | 47.78000 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | QIYQQEDMCSJOAC-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)n1nnc2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~85%
N-octanoyl benz... CAS#:58068-80-7 |
| Literature: Wedler, Christine; Kleiner, Katharina; Kunath, Annamarie; Schick, Hans Liebigs Annales, 1996 , # 6 p. 881 - 885 |
|
~%
N-octanoyl benz... CAS#:58068-80-7 |
| Literature: Katritzky, Alan R.; Moutou, Jean-Luc; Yang, Zhijun Organic Preparations and Procedures International, 1995 , vol. 27, # 3 p. 361 - 366 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(1H-Benzotriazol-1-yl)octan-1-one |
| 1-(1H-Benzotriazol-1-yl)-1-octanone |
| 1-Benzotriazol-1-yl-octan-1-one |
| 1-Octanone, 1-(1H-1,2,3-benzotriazol-1-yl)- |
| 1-OCTANOYLBENZOTRIAZOLE |
| 1-(n-octanoyl)benzotriazole |
| 1-(1H-Benzo[d][1,2,3]triazol-1-yl)octan-1-one |
| N-OCTANOYL BENZOTRIAZOLE |